C22H35NO7 — CID 102100222
CID 102100222 (PubChem CID 102100222) has the molecular formula C22H35NO7 and a molecular weight of 425.52 g/mol.
| Compound Name | CID 102100222 |
|---|---|
| PubChem CID | 102100222 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1C2(CCCC2)N(C)C[C@@]12[C@@H]([C@@H]1COC(C)(C)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C22H35NO7/c1-19(2)26-11-13(28-19)15-22(16-18(27-15)30-20(3,4)29-16)12-23(5)21(9-7-8-10-21)14(22)17(24)25-6/h13-16,18H,7-12H2,1-6H3/t13-,14+,15+,16-,18+,22-/m0/s1 |
| InChIKey | HDDUIALONRZWOT-ITYIGQPSSA-N |
| XLogP | 2.05 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |