C15H28O5 — CID 102191668
(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylhex-2-en-1-ol (PubChem CID 102191668) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylhex-2-en-1-ol.
| Compound Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylhex-2-en-1-ol |
|---|---|
| PubChem CID | 102191668 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylhex-2-en-1-ol |
| SMILES | CCC/C(C)=C/[C@@H](O)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C15H28O5/c1-7-8-11(2)9-12(16)13-10-19-14(3,17-5)15(4,18-6)20-13/h9,12-13,16H,7-8,10H2,1-6H3/b11-9+/t12-,13+,14-,15-/m1/s1 |
| InChIKey | MDBAHWDNUFEECF-SIEBDZCYSA-N |
| XLogP | 2.23 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|