C17H28O10 — CID 101414894
[(2R,3S)-2,3-diacetyloxy-3-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]propyl] acetate (PubChem CID 101414894) has the molecular formula C17H28O10 and a molecular weight of 392.40 g/mol. Its IUPAC name is [(2R,3S)-2,3-diacetyloxy-3-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]propyl] acetate.
| Compound Name | [(2R,3S)-2,3-diacetyloxy-3-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 101414894 |
| Molecular Formula | C17H28O10 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(2R,3S)-2,3-diacetyloxy-3-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]propyl] acetate |
| SMILES | CO[C@]1(C)OC[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O[C@@]1(C)OC |
| InChI | InChI=1S/C17H28O10/c1-10(18)23-8-13(25-11(2)19)15(26-12(3)20)14-9-24-16(4,21-6)17(5,22-7)27-14/h13-15H,8-9H2,1-7H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | MTXHUMFRIDWCKX-WRQOLXDDSA-N |
| XLogP | 0.55 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|