C12H18ClNO — CID 11470196
[(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]azanium chloride (PubChem CID 11470196) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is [(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]azanium chloride.
| Compound Name | [(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 11470196 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]azanium chloride |
| SMILES | CC(C)(C)[C@H]([NH3+])C(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H17NO.ClH/c1-12(2,3)11(13)10(14)9-7-5-4-6-8-9;/h4-8,11H,13H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | NBIFZBHKUBXRLD-RFVHGSKJSA-N |
| XLogP | -1.47 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |