C13H20ClNO2 — CID 85291295
(3,3-dimethyl-1-oxo-1-phenylmethoxybutan-2-yl)azanium chloride (PubChem CID 85291295) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is (3,3-dimethyl-1-oxo-1-phenylmethoxybutan-2-yl)azanium chloride.
| Compound Name | (3,3-dimethyl-1-oxo-1-phenylmethoxybutan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 85291295 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (3,3-dimethyl-1-oxo-1-phenylmethoxybutan-2-yl)azanium chloride |
| SMILES | CC(C)(C)C([NH3+])C(=O)OCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C13H19NO2.ClH/c1-13(2,3)11(14)12(15)16-9-10-7-5-4-6-8-10;/h4-8,11H,9,14H2,1-3H3;1H |
| InChIKey | DAMFALAMZHMNIN-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |