C14H14BrFO5 — CID 57072530
2-[(2R,3S,4R,5R)-3-acetyl-5-bromo-4-fluoro-3-hydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 57072530) has the molecular formula C14H14BrFO5 and a molecular weight of 361.16 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-3-acetyl-5-bromo-4-fluoro-3-hydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[(2R,3S,4R,5R)-3-acetyl-5-bromo-4-fluoro-3-hydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 57072530 |
| Molecular Formula | C14H14BrFO5 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-3-acetyl-5-bromo-4-fluoro-3-hydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | CC(=O)[C@@]1(O)[C@@H](C(O)C(=O)c2ccccc2)O[C@H](Br)[C@@H]1F |
| InChI | InChI=1S/C14H14BrFO5/c1-7(17)14(20)11(16)13(15)21-12(14)10(19)9(18)8-5-3-2-4-6-8/h2-6,10-13,19-20H,1H3/t10?,11-,12+,13-,14-/m0/s1 |
| InChIKey | YTGBUYIYQIPUDO-GTGGMXTKSA-N |
| XLogP | 1.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|