C28H23NO8S — CID 18607430
2-[(2R,3R,4R)-3,4-dibenzoyl-3,4,6-trihydroxy-6-isothiocyanatooxan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 18607430) has the molecular formula C28H23NO8S and a molecular weight of 533.56 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-3,4-dibenzoyl-3,4,6-trihydroxy-6-isothiocyanatooxan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[(2R,3R,4R)-3,4-dibenzoyl-3,4,6-trihydroxy-6-isothiocyanatooxan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 18607430 |
| Molecular Formula | C28H23NO8S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 2-[(2R,3R,4R)-3,4-dibenzoyl-3,4,6-trihydroxy-6-isothiocyanatooxan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(O)[C@H]1OC(O)(N=C=S)C[C@](O)(C(=O)c2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23NO8S/c30-21(18-10-4-1-5-11-18)22(31)25-28(36,24(33)20-14-8-3-9-15-20)26(34,16-27(35,37-25)29-17-38)23(32)19-12-6-2-7-13-19/h1-15,22,25,31,34-36H,16H2/t22?,25-,26+,27?,28-/m1/s1 |
| InChIKey | DXWBQOUUEDJIDM-IHZROLSFSA-N |
| XLogP | 2.00 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|