C24H20F2O9S — CID 87360164
[(2R,4S,5R)-3,3-difluoro-2,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)-4-(naphthalene-2-carbonyl)oxolan-2-yl] methanesulfonate (PubChem CID 87360164) has the molecular formula C24H20F2O9S and a molecular weight of 522.48 g/mol. Its IUPAC name is [(2R,4S,5R)-3,3-difluoro-2,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)-4-(naphthalene-2-carbonyl)oxolan-2-yl] methanesulfonate.
| Compound Name | [(2R,4S,5R)-3,3-difluoro-2,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)-4-(naphthalene-2-carbonyl)oxolan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 87360164 |
| Molecular Formula | C24H20F2O9S |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | [(2R,4S,5R)-3,3-difluoro-2,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)-4-(naphthalene-2-carbonyl)oxolan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@]1(O)O[C@H](C(O)C(=O)c2ccccc2)[C@](O)(C(=O)c2ccc3ccccc3c2)C1(F)F |
| InChI | InChI=1S/C24H20F2O9S/c1-36(32,33)35-24(31)23(25,26)22(30,20(29)17-12-11-14-7-5-6-10-16(14)13-17)21(34-24)19(28)18(27)15-8-3-2-4-9-15/h2-13,19,21,28,30-31H,1H3/t19?,21-,22-,24-/m1/s1 |
| InChIKey | JHIOGIBKUMZYFV-TWCSLKCUSA-N |
| XLogP | 1.65 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|