C13H16O7 — CID 174840639
[(2R,3R,4R,5S)-2-(1,2-dihydroxyethyl)-3,4,5-trihydroxyoxolan-3-yl]-phenylmethanone (PubChem CID 174840639) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(1,2-dihydroxyethyl)-3,4,5-trihydroxyoxolan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3R,4R,5S)-2-(1,2-dihydroxyethyl)-3,4,5-trihydroxyoxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174840639 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(1,2-dihydroxyethyl)-3,4,5-trihydroxyoxolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@]1(O)[C@@H](C(O)CO)O[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16O7/c14-6-8(15)11-13(19,10(17)12(18)20-11)9(16)7-4-2-1-3-5-7/h1-5,8,10-12,14-15,17-19H,6H2/t8?,10-,11+,12-,13+/m0/s1 |
| InChIKey | AOWQZGNEJHVYMR-FKQHRNAXSA-N |
| XLogP | -1.97 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |