C20H19ClO7 — CID 67553086
[(2S,3R,4S,5S,6R)-4-benzoyl-5-chloro-2,3-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate (PubChem CID 67553086) has the molecular formula C20H19ClO7 and a molecular weight of 406.82 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4-benzoyl-5-chloro-2,3-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4-benzoyl-5-chloro-2,3-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 67553086 |
| Molecular Formula | C20H19ClO7 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4-benzoyl-5-chloro-2,3-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate |
| SMILES | O=C(O[C@]1(C(=O)c2ccccc2)[C@@H](O)[C@@H](O)O[C@H](CO)[C@@H]1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H19ClO7/c21-15-14(11-22)27-19(26)17(24)20(15,16(23)12-7-3-1-4-8-12)28-18(25)13-9-5-2-6-10-13/h1-10,14-15,17,19,22,24,26H,11H2/t14-,15+,17+,19+,20-/m1/s1 |
| InChIKey | HDEOIMSGYMAQPL-YOJMASELSA-N |
| XLogP | 1.14 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|