C13H15NO9 — CID 70354647
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-nitrooxan-2-yl] benzoate (PubChem CID 70354647) has the molecular formula C13H15NO9 and a molecular weight of 329.26 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-nitrooxan-2-yl] benzoate.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-nitrooxan-2-yl] benzoate |
|---|---|
| PubChem CID | 70354647 |
| Molecular Formula | C13H15NO9 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-nitrooxan-2-yl] benzoate |
| SMILES | O=C(OC1([N+](=O)[O-])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO9/c15-6-8-9(16)10(17)11(18)13(22-8,14(20)21)23-12(19)7-4-2-1-3-5-7/h1-5,8-11,15-18H,6H2/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | GPHAWRRWYGYYBN-TWEVDUBQSA-N |
| XLogP | -1.75 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|