C26H21NO10 — CID 102461634
[(2R,3R,4R)-4-benzoyloxy-5-hydroxy-2-(hydroxymethyl)-5-(4-nitrobenzoyl)oxolan-3-yl] benzoate (PubChem CID 102461634) has the molecular formula C26H21NO10 and a molecular weight of 507.45 g/mol. Its IUPAC name is [(2R,3R,4R)-4-benzoyloxy-5-hydroxy-2-(hydroxymethyl)-5-(4-nitrobenzoyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R)-4-benzoyloxy-5-hydroxy-2-(hydroxymethyl)-5-(4-nitrobenzoyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 102461634 |
| Molecular Formula | C26H21NO10 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | [(2R,3R,4R)-4-benzoyloxy-5-hydroxy-2-(hydroxymethyl)-5-(4-nitrobenzoyl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@@H](OC(=O)c2ccccc2)C(O)(C(=O)c2ccc([N+](=O)[O-])cc2)O[C@@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C26H21NO10/c28-15-20-21(35-24(30)17-7-3-1-4-8-17)23(36-25(31)18-9-5-2-6-10-18)26(32,37-20)22(29)16-11-13-19(14-12-16)27(33)34/h1-14,20-21,23,28,32H,15H2/t20-,21-,23-,26?/m1/s1 |
| InChIKey | HVLVDSHZAVBSMI-XVXKENINSA-N |
| XLogP | 2.31 |
| TPSA | 162.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|