C22H25O7P — CID 90894961
[(2S,3S,5S)-4-benzoyloxy-2-ethyl-5-hydroxy-5-(phosphanylmethoxymethyl)oxolan-3-yl] benzoate (PubChem CID 90894961) has the molecular formula C22H25O7P and a molecular weight of 432.41 g/mol. Its IUPAC name is [(2S,3S,5S)-4-benzoyloxy-2-ethyl-5-hydroxy-5-(phosphanylmethoxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,5S)-4-benzoyloxy-2-ethyl-5-hydroxy-5-(phosphanylmethoxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90894961 |
| Molecular Formula | C22H25O7P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [(2S,3S,5S)-4-benzoyloxy-2-ethyl-5-hydroxy-5-(phosphanylmethoxymethyl)oxolan-3-yl] benzoate |
| SMILES | CC[C@@H]1O[C@@](O)(COCP)C(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H25O7P/c1-2-17-18(27-20(23)15-9-5-3-6-10-15)19(22(25,29-17)13-26-14-30)28-21(24)16-11-7-4-8-12-16/h3-12,17-19,25H,2,13-14,30H2,1H3/t17-,18-,19?,22-/m0/s1 |
| InChIKey | QFUSWSJBSDDCIN-LNTMXCLISA-N |
| XLogP | 2.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|