C21H21ClO7 — CID 68625484
2-[(2R,3S,4R)-5-chloro-3,4,5-trihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone (PubChem CID 68625484) has the molecular formula C21H21ClO7 and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-[(2R,3S,4R)-5-chloro-3,4,5-trihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone.
| Compound Name | 2-[(2R,3S,4R)-5-chloro-3,4,5-trihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 68625484 |
| Molecular Formula | C21H21ClO7 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[(2R,3S,4R)-5-chloro-3,4,5-trihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1C(=O)C(O)[C@H]1OC(O)(Cl)[C@H](O)[C@@]1(O)C(=O)c1ccccc1C |
| InChI | InChI=1S/C21H21ClO7/c1-11-7-3-5-9-13(11)15(23)16(24)18-20(27,19(26)21(22,28)29-18)17(25)14-10-6-4-8-12(14)2/h3-10,16,18-19,24,26-28H,1-2H3/t16?,18-,19-,20-,21?/m1/s1 |
| InChIKey | BLJWWJQKIDEYQG-NPZFLSJWSA-N |
| XLogP | 1.11 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|