C21H21ClO6 — CID 67633291
2-[(2R,3S,4S)-5-chloro-3,4-dihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone (PubChem CID 67633291) has the molecular formula C21H21ClO6 and a molecular weight of 404.85 g/mol. Its IUPAC name is 2-[(2R,3S,4S)-5-chloro-3,4-dihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone.
| Compound Name | 2-[(2R,3S,4S)-5-chloro-3,4-dihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 67633291 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[(2R,3S,4S)-5-chloro-3,4-dihydroxy-3-(2-methylbenzoyl)oxolan-2-yl]-2-hydroxy-1-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1C(=O)C(O)[C@H]1OC(Cl)[C@@H](O)[C@@]1(O)C(=O)c1ccccc1C |
| InChI | InChI=1S/C21H21ClO6/c1-11-7-3-5-9-13(11)15(23)16(24)19-21(27,18(26)20(22)28-19)17(25)14-10-6-4-8-12(14)2/h3-10,16,18-20,24,26-27H,1-2H3/t16?,18-,19-,20?,21+/m1/s1 |
| InChIKey | ZDBCJDSKTKBSGA-FIDDMVQESA-N |
| XLogP | 1.79 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|