C28H24O9 — CID 139898239
trans-(3R,5R)-3,4,5-tribenzoyl-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (PubChem CID 139898239) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is trans-(3R,5R)-3,4,5-tribenzoyl-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,4,5-tribenzoyl-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 139898239 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | trans-(3R,5R)-3,4,5-tribenzoyl-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C[C@](O)(C(=O)c2ccccc2)C(O)(C(=O)c2ccccc2)[C@@](O)(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H24O9/c29-21(18-10-4-1-5-11-18)26(35)16-25(34,24(32)33)17-27(36,22(30)19-12-6-2-7-13-19)28(26,37)23(31)20-14-8-3-9-15-20/h1-15,34-37H,16-17H2,(H,32,33)/t25?,26-,27-,28?/m0/s1 |
| InChIKey | IBSWYRKPFDFUGP-WKTGJHSFSA-N |
| XLogP | 1.44 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |