C20H22O8 — CID 151034583
phenyl-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-3-phenylmethoxyoxan-2-yl]methanone (PubChem CID 151034583) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is phenyl-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-3-phenylmethoxyoxan-2-yl]methanone.
| Compound Name | phenyl-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-3-phenylmethoxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 151034583 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | phenyl-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-3-phenylmethoxyoxan-2-yl]methanone |
| SMILES | O=C(c1ccccc1)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O8/c21-11-15-16(22)18(24)19(25,27-12-13-7-3-1-4-8-13)20(26,28-15)17(23)14-9-5-2-6-10-14/h1-10,15-16,18,21-22,24-26H,11-12H2/t15-,16-,18+,19+,20?/m1/s1 |
| InChIKey | MAUKSMAZMKSOTJ-GKPURMBKSA-N |
| XLogP | -0.42 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|