C20H22O10 — CID 141056943
2-[(2R,3R,4S,5S,6R)-3-benzyl-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carbonyl]cyclohexane-1,3,5-trione (PubChem CID 141056943) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3-benzyl-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carbonyl]cyclohexane-1,3,5-trione.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3-benzyl-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carbonyl]cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 141056943 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3-benzyl-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carbonyl]cyclohexane-1,3,5-trione |
| SMILES | O=C1CC(=O)C(C(=O)[C@]2(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@]2(O)Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C20H22O10/c21-9-14-16(25)18(27)19(28,8-10-4-2-1-3-5-10)20(29,30-14)17(26)15-12(23)6-11(22)7-13(15)24/h1-5,14-16,18,21,25,27-29H,6-9H2/t14-,16-,18+,19-,20+/m1/s1 |
| InChIKey | QSZDEOKVZSKJEJ-ULKVZQIESA-N |
| XLogP | -2.55 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|