C18H27NO8 — CID 66764279
benzyl N-[4-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]carbamate (PubChem CID 66764279) has the molecular formula C18H27NO8 and a molecular weight of 385.41 g/mol. Its IUPAC name is benzyl N-[4-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 66764279 |
| Molecular Formula | C18H27NO8 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | benzyl N-[4-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]carbamate |
| SMILES | O=C(NCCCC[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO8/c20-10-13-14(21)15(22)16(23)18(25,27-13)8-4-5-9-19-17(24)26-11-12-6-2-1-3-7-12/h1-3,6-7,13-16,20-23,25H,4-5,8-11H2,(H,19,24)/t13-,14-,15+,16+,18-/m1/s1 |
| InChIKey | TUULGFVDPBEJHB-KCYAQADSSA-N |
| XLogP | -0.75 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|