C19H28N2O8 — CID 139329206
(2S)-6-(phenylmethoxycarbonylamino)-2-[(2,3,4-trihydroxyoxolan-2-yl)methylamino]hexanoic acid (PubChem CID 139329206) has the molecular formula C19H28N2O8 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2S)-6-(phenylmethoxycarbonylamino)-2-[(2,3,4-trihydroxyoxolan-2-yl)methylamino]hexanoic acid.
| Compound Name | (2S)-6-(phenylmethoxycarbonylamino)-2-[(2,3,4-trihydroxyoxolan-2-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 139329206 |
| Molecular Formula | C19H28N2O8 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (2S)-6-(phenylmethoxycarbonylamino)-2-[(2,3,4-trihydroxyoxolan-2-yl)methylamino]hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NCC1(O)OCC(O)C1O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O8/c22-15-11-29-19(27,16(15)23)12-21-14(17(24)25)8-4-5-9-20-18(26)28-10-13-6-2-1-3-7-13/h1-3,6-7,14-16,21-23,27H,4-5,8-12H2,(H,20,26)(H,24,25)/t14-,15?,16?,19?/m0/s1 |
| InChIKey | PSRDVSHXPMBMTA-DKWICNMVSA-N |
| XLogP | -0.43 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|