C18H26N2O8 — CID 139581808
(2S)-2-(phenylmethoxycarbonylamino)-5-[[(3R,4R)-2,3,4-trihydroxyoxolan-2-yl]methylamino]pentanoic acid (PubChem CID 139581808) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxycarbonylamino)-5-[[(3R,4R)-2,3,4-trihydroxyoxolan-2-yl]methylamino]pentanoic acid.
| Compound Name | (2S)-2-(phenylmethoxycarbonylamino)-5-[[(3R,4R)-2,3,4-trihydroxyoxolan-2-yl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 139581808 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2S)-2-(phenylmethoxycarbonylamino)-5-[[(3R,4R)-2,3,4-trihydroxyoxolan-2-yl]methylamino]pentanoic acid |
| SMILES | O=C(N[C@@H](CCCNCC1(O)OC[C@@H](O)[C@H]1O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O8/c21-14-10-28-18(26,15(14)22)11-19-8-4-7-13(16(23)24)20-17(25)27-9-12-5-2-1-3-6-12/h1-3,5-6,13-15,19,21-22,26H,4,7-11H2,(H,20,25)(H,23,24)/t13-,14+,15+,18?/m0/s1 |
| InChIKey | HIXZBJMMLVGKDB-BAJUWEDNSA-N |
| XLogP | -0.82 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|