C15H20N2O6 — CID 10671382
(2S)-5-[acetyl(hydroxy)amino]-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 10671382) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2S)-5-[acetyl(hydroxy)amino]-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-[acetyl(hydroxy)amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 10671382 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2S)-5-[acetyl(hydroxy)amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC(=O)N(O)CCC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c1-11(18)17(22)9-5-8-13(14(19)20)16-15(21)23-10-12-6-3-2-4-7-12/h2-4,6-7,13,22H,5,8-10H2,1H3,(H,16,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | UCQKROFCSYJIGA-ZDUSSCGKSA-N |
| XLogP | 1.38 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|