C21H32N2O8 — CID 22812663
benzyl N-[7-oxo-7-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]heptyl]carbamate (PubChem CID 22812663) has the molecular formula C21H32N2O8 and a molecular weight of 440.49 g/mol. Its IUPAC name is benzyl N-[7-oxo-7-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]heptyl]carbamate.
| Compound Name | benzyl N-[7-oxo-7-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]heptyl]carbamate |
|---|---|
| PubChem CID | 22812663 |
| Molecular Formula | C21H32N2O8 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | benzyl N-[7-oxo-7-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]heptyl]carbamate |
| SMILES | O=C(CCCCCCNC(=O)OCc1ccccc1)N[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H32N2O8/c24-12-15-17(26)18(27)19(28)20(31-15)23-16(25)10-6-1-2-7-11-22-21(29)30-13-14-8-4-3-5-9-14/h3-5,8-9,15,17-20,24,26-28H,1-2,6-7,10-13H2,(H,22,29)(H,23,25)/t15-,17+,18+,19-,20-/m1/s1 |
| InChIKey | AMEPZYKMRDDTSZ-DABHTEOTSA-N |
| XLogP | -0.22 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|