C32H52N2O15 — CID 171563874
benzyl N-[6-[bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-6-oxohexyl]carbamate (PubChem CID 171563874) has the molecular formula C32H52N2O15 and a molecular weight of 704.77 g/mol. Its IUPAC name is benzyl N-[6-[bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-[bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 171563874 |
| Molecular Formula | C32H52N2O15 |
| Molecular Weight | 704.77 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | benzyl N-[6-[bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-6-oxohexyl]carbamate |
| SMILES | O=C(NCCCCCC(=O)N(CCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)CCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C32H52N2O15/c35-17-21-24(38)26(40)28(42)30(48-21)45-15-7-13-34(14-8-16-46-31-29(43)27(41)25(39)22(18-36)49-31)23(37)11-5-2-6-12-33-32(44)47-19-20-9-3-1-4-10-20/h1,3-4,9-10,21-22,24-31,35-36,38-43H,2,5-8,11-19H2,(H,33,44)/t21-,22-,24-,25-,26+,27+,28+,29+,30+,31+/m1/s1 |
| InChIKey | MOGGKDQYXYMTJF-FUJKBGOISA-N |
| XLogP | -2.29 |
| TPSA | 257.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.77 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|