C28H35Cl3N2O8 — CID 166498013
benzyl N-[5-[(2R,3S,5S)-4,5-dihydroxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]oxypentyl]carbamate (PubChem CID 166498013) has the molecular formula C28H35Cl3N2O8 and a molecular weight of 633.95 g/mol. Its IUPAC name is benzyl N-[5-[(2R,3S,5S)-4,5-dihydroxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]oxypentyl]carbamate.
| Compound Name | benzyl N-[5-[(2R,3S,5S)-4,5-dihydroxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]oxypentyl]carbamate |
|---|---|
| PubChem CID | 166498013 |
| Molecular Formula | C28H35Cl3N2O8 |
| Molecular Weight | 633.95 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | benzyl N-[5-[(2R,3S,5S)-4,5-dihydroxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]oxypentyl]carbamate |
| SMILES | O=C(NCCCCCO[C@@H]1OC(COCc2ccccc2)[C@@H](O)C(O)[C@@H]1NC(=O)C(Cl)(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C28H35Cl3N2O8/c29-28(30,31)26(36)33-22-24(35)23(34)21(18-38-16-19-10-4-1-5-11-19)41-25(22)39-15-9-3-8-14-32-27(37)40-17-20-12-6-2-7-13-20/h1-2,4-7,10-13,21-25,34-35H,3,8-9,14-18H2,(H,32,37)(H,33,36)/t21?,22-,23+,24?,25+/m0/s1 |
| InChIKey | OFONYAUHPLFSIM-FIASGLRTSA-N |
| XLogP | 3.62 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|