C27H47N3O11P+ — CID 11181102
2-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-[6-(phenylmethoxycarbonylamino)hexoxy]oxan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 11181102) has the molecular formula C27H47N3O11P+ and a molecular weight of 620.66 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-[6-(phenylmethoxycarbonylamino)hexoxy]oxan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-[6-(phenylmethoxycarbonylamino)hexoxy]oxan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11181102 |
| Molecular Formula | C27H47N3O11P+ |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 2-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-[6-(phenylmethoxycarbonylamino)hexoxy]oxan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCCCNC(=O)OCc2ccccc2)O[C@H](COP(=O)(O)OCC[N+](C)(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H46N3O11P/c1-20(31)29-23-25(33)24(32)22(19-40-42(35,36)39-17-15-30(2,3)4)41-26(23)37-16-11-6-5-10-14-28-27(34)38-18-21-12-8-7-9-13-21/h7-9,12-13,22-26,32-33H,5-6,10-11,14-19H2,1-4H3,(H2-,28,29,31,34,35,36)/p+1/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | KWBRYDHQDPSMCG-WSGIOKLISA-O |
| XLogP | 1.28 |
| TPSA | 182.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|