C15H25N2O6P — CID 154984320
2-(phenylmethoxycarbonylamino)ethyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 154984320) has the molecular formula C15H25N2O6P and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylamino)ethyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-(phenylmethoxycarbonylamino)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 154984320 |
| Molecular Formula | C15H25N2O6P |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(phenylmethoxycarbonylamino)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H25N2O6P/c1-17(2,3)10-12-23-24(19,20)22-11-9-16-15(18)21-13-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H-,16,18,19,20) |
| InChIKey | MFQSXCAXQRTIMK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|