C34H55BN3O15P — CID 174092181
CID 174092181 (PubChem CID 174092181) has the molecular formula C34H55BN3O15P and a molecular weight of 787.61 g/mol.
| Compound Name | CID 174092181 |
|---|---|
| PubChem CID | 174092181 |
| Molecular Formula | C34H55BN3O15P |
| Molecular Weight | 787.61 g/mol |
| Exact Mass | 787.35 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(=O)OCc2ccccc2)C(OP(=O)(O)OC)[C@@H]1CCCCCCCNC(=O)NCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C34H55BN3O15P/c1-22(40)38-27-29(42)28(41)25(19-39)52-32(27)48-18-12-11-17-37-33(43)36-16-10-5-3-4-9-15-24-30(53-54(45,46)47-2)26(51-31(24)35)21-50-34(44)49-20-23-13-7-6-8-14-23/h6-8,13-14,24-32,39,41-42H,3-5,9-12,15-21H2,1-2H3,(H,38,40)(H,45,46)(H2,36,37,43)/t24-,25+,26+,27+,28-,29+,30?,31+,32+/m0/s1 |
| InChIKey | ATIUVBNPDQQHJI-YZCUIEDVSA-N |
| XLogP | 1.36 |
| TPSA | 249.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.61 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|