C36H52BN2O17PS — CID 174092184
CID 174092184 (PubChem CID 174092184) has the molecular formula C36H52BN2O17PS and a molecular weight of 858.66 g/mol.
| Compound Name | CID 174092184 |
|---|---|
| PubChem CID | 174092184 |
| Molecular Formula | C36H52BN2O17PS |
| Molecular Weight | 858.66 g/mol |
| Exact Mass | 858.28 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(=O)OCc2ccccc2)C(OP(=O)(O)OC)[C@@H]1CCCNC(=S)CCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C36H52BN2O17PS/c1-21(40)39-30-33(53-24(4)43)32(52-23(3)42)28(19-49-22(2)41)55-35(30)48-17-10-9-15-29(58)38-16-11-14-26-31(56-57(45,46)47-5)27(54-34(26)37)20-51-36(44)50-18-25-12-7-6-8-13-25/h6-8,12-13,26-28,30-35H,9-11,14-20H2,1-5H3,(H,38,58)(H,39,40)(H,45,46)/t26-,27+,28+,30+,31?,32-,33+,34+,35+/m0/s1 |
| InChIKey | KPRRXLGMFPHHQZ-WYBWMDKYSA-N |
| XLogP | 2.52 |
| TPSA | 239.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|