C30H47BN3O13PS2 — CID 174092195
CID 174092195 (PubChem CID 174092195) has the molecular formula C30H47BN3O13PS2 and a molecular weight of 763.63 g/mol.
| Compound Name | CID 174092195 |
|---|---|
| PubChem CID | 174092195 |
| Molecular Formula | C30H47BN3O13PS2 |
| Molecular Weight | 763.63 g/mol |
| Exact Mass | 763.24 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(=O)OCc2ccccc2)C(OP(O)(=S)OC)[C@@H]1CCCNC(=S)NCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C30H47BN3O13PS2/c1-18(36)34-23-25(38)24(37)21(15-35)46-28(23)42-14-7-6-12-32-29(49)33-13-8-11-20-26(47-48(40,50)41-2)22(45-27(20)31)17-44-30(39)43-16-19-9-4-3-5-10-19/h3-5,9-10,20-28,35,37-38H,6-8,11-17H2,1-2H3,(H,34,36)(H,40,50)(H2,32,33,49)/t20-,21+,22+,23+,24-,25+,26?,27+,28+,48?/m0/s1 |
| InChIKey | IZTBSAJIXWXAJX-HFPOQYSTSA-N |
| XLogP | 0.08 |
| TPSA | 215.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.63 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|