C27H51BN3O12PS — CID 174092117
CID 174092117 (PubChem CID 174092117) has the molecular formula C27H51BN3O12PS and a molecular weight of 683.57 g/mol.
| Compound Name | CID 174092117 |
|---|---|
| PubChem CID | 174092117 |
| Molecular Formula | C27H51BN3O12PS |
| Molecular Weight | 683.57 g/mol |
| Exact Mass | 683.30 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OP(O)(=S)OC)[C@@H]1CCCCCCCNC(=O)NCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C27H51BN3O12PS/c1-17(33)31-21-23(35)22(34)19(15-32)42-26(21)40-14-10-9-13-30-27(36)29-12-8-6-4-5-7-11-18-24(43-44(37,45)39-3)20(16-38-2)41-25(18)28/h18-26,32,34-35H,4-16H2,1-3H3,(H,31,33)(H,37,45)(H2,29,30,36)/t18-,19+,20+,21+,22-,23+,24?,25+,26+,44?/m0/s1 |
| InChIKey | GCRMITMQHYXGMR-JRAQRPACSA-N |
| XLogP | -0.23 |
| TPSA | 206.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.57 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|