C27H48BN2O12PS — CID 174092106
CID 174092106 (PubChem CID 174092106) has the molecular formula C27H48BN2O12PS and a molecular weight of 666.54 g/mol.
| Compound Name | CID 174092106 |
|---|---|
| PubChem CID | 174092106 |
| Molecular Formula | C27H48BN2O12PS |
| Molecular Weight | 666.54 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)[C@H](OP(O)(=S)OC)C1C/C=C/CCCCNC(=O)CCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C27H48BN2O12PS/c1-17(32)30-22-24(35)23(34)19(15-31)41-27(22)39-14-10-8-12-21(33)29-13-9-6-4-5-7-11-18-25(42-43(36,44)38-3)20(16-37-2)40-26(18)28/h5,7,18-20,22-27,31,34-35H,4,6,8-16H2,1-3H3,(H,29,33)(H,30,32)(H,36,44)/b7-5+/t18?,19-,20-,22-,23+,24-,25-,26-,27-,43?/m1/s1 |
| InChIKey | KPQOOPUVFZFFQF-RKEWJWLSSA-N |
| XLogP | -0.25 |
| TPSA | 194.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.54 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|