C30H46BN2O14PS — CID 174092185
CID 174092185 (PubChem CID 174092185) has the molecular formula C30H46BN2O14PS and a molecular weight of 732.55 g/mol.
| Compound Name | CID 174092185 |
|---|---|
| PubChem CID | 174092185 |
| Molecular Formula | C30H46BN2O14PS |
| Molecular Weight | 732.55 g/mol |
| Exact Mass | 732.25 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(=O)OCc2ccccc2)C(OP(=O)(O)OC)[C@@H]1CCCNC(=S)CCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C30H46BN2O14PS/c1-18(35)33-24-26(37)25(36)21(15-34)46-29(24)42-14-7-6-12-23(49)32-13-8-11-20-27(47-48(39,40)41-2)22(45-28(20)31)17-44-30(38)43-16-19-9-4-3-5-10-19/h3-5,9-10,20-22,24-29,34,36-37H,6-8,11-17H2,1-2H3,(H,32,49)(H,33,35)(H,39,40)/t20-,21+,22+,24+,25-,26+,27?,28+,29+/m0/s1 |
| InChIKey | XNIBYVXAGFNKCM-ISUFEITASA-N |
| XLogP | 0.81 |
| TPSA | 220.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|