C29H49BN3O15PS — CID 174092112
CID 174092112 (PubChem CID 174092112) has the molecular formula C29H49BN3O15PS and a molecular weight of 753.57 g/mol.
| Compound Name | CID 174092112 |
|---|---|
| PubChem CID | 174092112 |
| Molecular Formula | C29H49BN3O15PS |
| Molecular Weight | 753.57 g/mol |
| Exact Mass | 753.27 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OP(O)(=S)OC)[C@@H]1CCCNC(=O)NCCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C29H49BN3O15PS/c1-16(34)33-23-26(45-19(4)37)25(44-18(3)36)22(15-43-17(2)35)47-28(23)42-13-8-7-11-31-29(38)32-12-9-10-20-24(48-49(39,50)41-6)21(14-40-5)46-27(20)30/h20-28H,7-15H2,1-6H3,(H,33,34)(H,39,50)(H2,31,32,38)/t20-,21+,22+,23+,24?,25-,26+,27+,28+,49?/m0/s1 |
| InChIKey | UNYFRNLKHGTXQG-IDWZPPKYSA-N |
| XLogP | -0.08 |
| TPSA | 224.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.57 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|