C15H30NO9P — CID 169069416
5-[3-acetamido-4,5-dihydroxy-6-(methoxymethyl)oxan-2-yl]oxypentoxy-methylphosphinic acid (PubChem CID 169069416) has the molecular formula C15H30NO9P and a molecular weight of 399.38 g/mol. Its IUPAC name is 5-[3-acetamido-4,5-dihydroxy-6-(methoxymethyl)oxan-2-yl]oxypentoxy-methylphosphinic acid.
| Compound Name | 5-[3-acetamido-4,5-dihydroxy-6-(methoxymethyl)oxan-2-yl]oxypentoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 169069416 |
| Molecular Formula | C15H30NO9P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 5-[3-acetamido-4,5-dihydroxy-6-(methoxymethyl)oxan-2-yl]oxypentoxy-methylphosphinic acid |
| SMILES | COCC1OC(OCCCCCOP(C)(=O)O)C(NC(C)=O)C(O)C1O |
| InChI | InChI=1S/C15H30NO9P/c1-10(17)16-12-14(19)13(18)11(9-22-2)25-15(12)23-7-5-4-6-8-24-26(3,20)21/h11-15,18-19H,4-9H2,1-3H3,(H,16,17)(H,20,21) |
| InChIKey | NWCLLZHDVZFKMY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|