C43H33BNO8PS — CID 174092026
CID 174092026 (PubChem CID 174092026) has the molecular formula C43H33BNO8PS and a molecular weight of 765.59 g/mol.
| Compound Name | CID 174092026 |
|---|---|
| PubChem CID | 174092026 |
| Molecular Formula | C43H33BNO8PS |
| Molecular Weight | 765.59 g/mol |
| Exact Mass | 765.18 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(=O)OCc2ccccc2)C(OP(O)(=S)OC)[C@@H]1C/C=C/CCCCNC(=O)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C43H33BNO8PS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-28-33-40(46)45-34-29-23-20-21-27-32-38-41(53-54(48,55)49-2)39(52-42(38)44)36-51-43(47)50-35-37-30-25-24-26-31-37/h21,24-27,30-31,38-39,41-42H,20,23,29,32,34-36H2,1-2H3,(H,45,46)(H,48,55)/b27-21+/t38-,39+,41?,42+,54?/m0/s1 |
| InChIKey | DBJJRPIVZVPSAJ-YAPLKNIBSA-N |
| XLogP | 3.38 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|