C27H37N4O10PS — CID 174092067
benzyl [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(methoxy)phosphinothioyl]oxy-4-[(E)-7-(methylcarbamoylamino)hept-2-enyl]oxolan-2-yl]methyl carbonate (PubChem CID 174092067) has the molecular formula C27H37N4O10PS and a molecular weight of 640.65 g/mol. Its IUPAC name is benzyl [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(methoxy)phosphinothioyl]oxy-4-[(E)-7-(methylcarbamoylamino)hept-2-enyl]oxolan-2-yl]methyl carbonate.
| Compound Name | benzyl [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(methoxy)phosphinothioyl]oxy-4-[(E)-7-(methylcarbamoylamino)hept-2-enyl]oxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 174092067 |
| Molecular Formula | C27H37N4O10PS |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | benzyl [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(methoxy)phosphinothioyl]oxy-4-[(E)-7-(methylcarbamoylamino)hept-2-enyl]oxolan-2-yl]methyl carbonate |
| SMILES | CNC(=O)NCCCC/C=C/CC1[C@@H](OP(O)(=S)OC)[C@@H](COC(=O)OCc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C27H37N4O10PS/c1-28-25(33)29-15-10-5-3-4-9-13-20-23(41-42(36,43)37-2)21(40-24(20)31-16-14-22(32)30-26(31)34)18-39-27(35)38-17-19-11-7-6-8-12-19/h4,6-9,11-12,14,16,20-21,23-24H,3,5,10,13,15,17-18H2,1-2H3,(H,36,43)(H2,28,29,33)(H,30,32,34)/b9-4+/t20?,21-,23-,24-,42?/m1/s1 |
| InChIKey | RLEUPURBIRQBKJ-KQSCGGMHSA-N |
| XLogP | 2.70 |
| TPSA | 179.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|