C21H29N4O11P — CID 174091956
[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 174091956) has the molecular formula C21H29N4O11P and a molecular weight of 544.45 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 174091956 |
| Molecular Formula | C21H29N4O11P |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](CCCNC(=O)CCN2C(=O)C=CC2=O)C1OP(=O)(O)OC |
| InChI | InChI=1S/C21H29N4O11P/c1-33-12-14-19(36-37(31,32)34-2)13(20(35-14)25-11-8-16(27)23-21(25)30)4-3-9-22-15(26)7-10-24-17(28)5-6-18(24)29/h5-6,8,11,13-14,19-20H,3-4,7,9-10,12H2,1-2H3,(H,22,26)(H,31,32)(H,23,27,30)/t13-,14+,19?,20+/m0/s1 |
| InChIKey | PHBPDOFUVIFISL-HODKIQDHSA-N |
| XLogP | -0.96 |
| TPSA | 195.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|