C25H46N2O14 — CID 170422234
6-(propanoylamino)-N,N-bis[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]hexanamide (PubChem CID 170422234) has the molecular formula C25H46N2O14 and a molecular weight of 598.64 g/mol. Its IUPAC name is 6-(propanoylamino)-N,N-bis[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]hexanamide.
| Compound Name | 6-(propanoylamino)-N,N-bis[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]hexanamide |
|---|---|
| PubChem CID | 170422234 |
| Molecular Formula | C25H46N2O14 |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 6-(propanoylamino)-N,N-bis[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]hexanamide |
| SMILES | CCC(=O)NCCCCCC(=O)N(CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H46N2O14/c1-2-16(30)26-7-5-3-4-6-17(31)27(8-10-38-24-22(36)20(34)18(32)14(12-28)40-24)9-11-39-25-23(37)21(35)19(33)15(13-29)41-25/h14-15,18-25,28-29,32-37H,2-13H2,1H3,(H,26,30)/t14-,15-,18-,19-,20+,21+,22+,23+,24+,25+/m1/s1 |
| InChIKey | QHHGRLKHFUTUIU-WTJLOSJRSA-N |
| XLogP | -4.47 |
| TPSA | 248.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|