C27H36N2O12 — CID 22812634
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[5-(phenylmethoxycarbonylamino)pentanoylamino]oxan-2-yl]methyl acetate (PubChem CID 22812634) has the molecular formula C27H36N2O12 and a molecular weight of 580.59 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[5-(phenylmethoxycarbonylamino)pentanoylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[5-(phenylmethoxycarbonylamino)pentanoylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22812634 |
| Molecular Formula | C27H36N2O12 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[5-(phenylmethoxycarbonylamino)pentanoylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)CCCCNC(=O)OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H36N2O12/c1-16(30)36-15-21-23(38-17(2)31)24(39-18(3)32)25(40-19(4)33)26(41-21)29-22(34)12-8-9-13-28-27(35)37-14-20-10-6-5-7-11-20/h5-7,10-11,21,23-26H,8-9,12-15H2,1-4H3,(H,28,35)(H,29,34)/t21-,23-,24+,25+,26-/m1/s1 |
| InChIKey | DLOVEYPMGYPPJU-BMLQBVLXSA-N |
| XLogP | 1.28 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|