C34H35FO5 — CID 18667412
(2R,3R,4S,5R)-4,5,6-tribenzyl-6-fluoro-2-(hydroxymethyl)-5-phenylmethoxyoxane-3,4-diol (PubChem CID 18667412) has the molecular formula C34H35FO5 and a molecular weight of 542.65 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4,5,6-tribenzyl-6-fluoro-2-(hydroxymethyl)-5-phenylmethoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-4,5,6-tribenzyl-6-fluoro-2-(hydroxymethyl)-5-phenylmethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 18667412 |
| Molecular Formula | C34H35FO5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (2R,3R,4S,5R)-4,5,6-tribenzyl-6-fluoro-2-(hydroxymethyl)-5-phenylmethoxyoxane-3,4-diol |
| SMILES | OC[C@H]1OC(F)(Cc2ccccc2)[C@](Cc2ccccc2)(OCc2ccccc2)[C@](O)(Cc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C34H35FO5/c35-34(23-28-17-9-3-10-18-28)33(22-27-15-7-2-8-16-27,39-25-29-19-11-4-12-20-29)32(38,31(37)30(24-36)40-34)21-26-13-5-1-6-14-26/h1-20,30-31,36-38H,21-25H2/t30-,31-,32+,33-,34?/m1/s1 |
| InChIKey | CQHJVIZKESCEGK-BKJHVTENSA-N |
| XLogP | 4.82 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |