C26H28O5 — CID 141224072
(3R,4S,5R)-3,4-dibenzyl-5-(phenylmethoxymethyl)oxolane-2,3,4-triol (PubChem CID 141224072) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (3R,4S,5R)-3,4-dibenzyl-5-(phenylmethoxymethyl)oxolane-2,3,4-triol.
| Compound Name | (3R,4S,5R)-3,4-dibenzyl-5-(phenylmethoxymethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 141224072 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (3R,4S,5R)-3,4-dibenzyl-5-(phenylmethoxymethyl)oxolane-2,3,4-triol |
| SMILES | OC1O[C@H](COCc2ccccc2)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C26H28O5/c27-24-26(29,17-21-12-6-2-7-13-21)25(28,16-20-10-4-1-5-11-20)23(31-24)19-30-18-22-14-8-3-9-15-22/h1-15,23-24,27-29H,16-19H2/t23-,24?,25+,26+/m1/s1 |
| InChIKey | PORTZUWVRWIUMK-WLXDULSJSA-N |
| XLogP | 2.87 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |