C34H36O6 — CID 18664957
(3R,4S,5R,6R)-3,4-dibenzyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol (PubChem CID 18664957) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4-dibenzyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol.
| Compound Name | (3R,4S,5R,6R)-3,4-dibenzyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol |
|---|---|
| PubChem CID | 18664957 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (3R,4S,5R,6R)-3,4-dibenzyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol |
| SMILES | OC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C34H36O6/c35-32-34(37,22-27-15-7-2-8-16-27)33(36,21-26-13-5-1-6-14-26)31(39-24-29-19-11-4-12-20-29)30(40-32)25-38-23-28-17-9-3-10-18-28/h1-20,30-32,35-37H,21-25H2/t30-,31-,32?,33+,34+/m1/s1 |
| InChIKey | XCSYPKXAFYMYGS-JLLCWBOFSA-N |
| XLogP | 4.45 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |