C27H28O6 — CID 141184426
(2S,3R,4R,5R)-3,4-dibenzyl-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolane-2-carboxylic acid (PubChem CID 141184426) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3,4-dibenzyl-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolane-2-carboxylic acid.
| Compound Name | (2S,3R,4R,5R)-3,4-dibenzyl-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 141184426 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (2S,3R,4R,5R)-3,4-dibenzyl-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@H](COCc2ccccc2)[C@](O)(Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C27H28O6/c28-25(29)24-27(31,17-21-12-6-2-7-13-21)26(30,16-20-10-4-1-5-11-20)23(33-24)19-32-18-22-14-8-3-9-15-22/h1-15,23-24,30-31H,16-19H2,(H,28,29)/t23-,24-,26-,27-/m1/s1 |
| InChIKey | LBSPDOCHFZAPEG-UDCKCYQBSA-N |
| XLogP | 3.00 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |