C37H42O6 — CID 98170546
(2R,3R,4S,5R,6S)-3,4,5-trimethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 98170546) has the molecular formula C37H42O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3,4,5-trimethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6S)-3,4,5-trimethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 98170546 |
| Molecular Formula | C37H42O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3,4,5-trimethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | C[C@@]1(OCc2ccccc2)[C@@](C)(OCc2ccccc2)[C@H](O)O[C@@H](COCc2ccccc2)[C@@]1(C)OCc1ccccc1 |
| InChI | InChI=1S/C37H42O6/c1-35(40-25-30-18-10-5-11-19-30)33(28-39-24-29-16-8-4-9-17-29)43-34(38)36(2,41-26-31-20-12-6-13-21-31)37(35,3)42-27-32-22-14-7-15-23-32/h4-23,33-34,38H,24-28H2,1-3H3/t33-,34+,35+,36-,37-/m0/s1 |
| InChIKey | HPIMISFLESNLJG-OSWUWPNASA-N |
| XLogP | 6.85 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |