C28H37NO4 — CID 135023732
(2R,4Z,8R,9R)-N,N,4,8-tetramethyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-3,6,7,9-tetrahydro-2H-oxonine-2-carboxamide (PubChem CID 135023732) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is (2R,4Z,8R,9R)-N,N,4,8-tetramethyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-3,6,7,9-tetrahydro-2H-oxonine-2-carboxamide.
| Compound Name | (2R,4Z,8R,9R)-N,N,4,8-tetramethyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-3,6,7,9-tetrahydro-2H-oxonine-2-carboxamide |
|---|---|
| PubChem CID | 135023732 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | (2R,4Z,8R,9R)-N,N,4,8-tetramethyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-3,6,7,9-tetrahydro-2H-oxonine-2-carboxamide |
| SMILES | C/C1=C/CC[C@@](C)(OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H](C(=O)N(C)C)C1 |
| InChI | InChI=1S/C28H37NO4/c1-22-12-11-17-28(2,32-20-24-15-9-6-10-16-24)26(33-25(18-22)27(30)29(3)4)21-31-19-23-13-7-5-8-14-23/h5-10,12-16,25-26H,11,17-21H2,1-4H3/b22-12-/t25-,26-,28-/m1/s1 |
| InChIKey | AUFCYGRSDXFHGN-HVEPOFHMSA-N |
| XLogP | 5.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|