C32H48O5Si — CID 11398609
methyl (1R,2S,3R,4R,7R,8R,10Z,14R)-6,10,14-trimethyl-4-phenylmethoxy-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-diene-3-carboxylate (PubChem CID 11398609) has the molecular formula C32H48O5Si and a molecular weight of 540.82 g/mol. Its IUPAC name is methyl (1R,2S,3R,4R,7R,8R,10Z,14R)-6,10,14-trimethyl-4-phenylmethoxy-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-diene-3-carboxylate.
| Compound Name | methyl (1R,2S,3R,4R,7R,8R,10Z,14R)-6,10,14-trimethyl-4-phenylmethoxy-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-diene-3-carboxylate |
|---|---|
| PubChem CID | 11398609 |
| Molecular Formula | C32H48O5Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | methyl (1R,2S,3R,4R,7R,8R,10Z,14R)-6,10,14-trimethyl-4-phenylmethoxy-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-diene-3-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC/C=C(/C)C[C@H]2O[C@@H]1[C@@H]1[C@@H](C(=O)OC)[C@H](OCc3ccccc3)C=C(C)[C@@H]12 |
| InChI | InChI=1S/C32H48O5Si/c1-8-38(9-2,10-3)37-32(6)18-14-15-22(4)19-26-27-23(5)20-25(35-21-24-16-12-11-13-17-24)28(31(33)34-7)29(27)30(32)36-26/h11-13,15-17,20,25-30H,8-10,14,18-19,21H2,1-7H3/b22-15-/t25-,26-,27-,28+,29+,30-,32-/m1/s1 |
| InChIKey | CIHDEBBGNAJYOQ-DTBOWXNESA-N |
| XLogP | 7.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|