C21H33NO5Si — CID 134864947
1-O-benzyl 2-O-methyl (2S,3R)-3-methyl-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 134864947) has the molecular formula C21H33NO5Si and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3R)-3-methyl-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3R)-3-methyl-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134864947 |
| Molecular Formula | C21H33NO5Si |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3R)-3-methyl-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CCN(C(=O)OCc2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H33NO5Si/c1-6-28(7-2,8-3)27-21(4)14-15-22(18(21)19(23)25-5)20(24)26-16-17-12-10-9-11-13-17/h9-13,18H,6-8,14-16H2,1-5H3/t18-,21-/m1/s1 |
| InChIKey | JWEGAAIFHQAEFY-WIYYLYMNSA-N |
| XLogP | 4.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|