C23H26O4 — CID 102594717
[(1R,2S,7R,8R,9R,12Z)-9,13-dimethyl-4-oxo-15-oxatricyclo[6.6.1.02,7]pentadeca-5,12-dien-9-yl] benzoate (PubChem CID 102594717) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(1R,2S,7R,8R,9R,12Z)-9,13-dimethyl-4-oxo-15-oxatricyclo[6.6.1.02,7]pentadeca-5,12-dien-9-yl] benzoate.
| Compound Name | [(1R,2S,7R,8R,9R,12Z)-9,13-dimethyl-4-oxo-15-oxatricyclo[6.6.1.02,7]pentadeca-5,12-dien-9-yl] benzoate |
|---|---|
| PubChem CID | 102594717 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(1R,2S,7R,8R,9R,12Z)-9,13-dimethyl-4-oxo-15-oxatricyclo[6.6.1.02,7]pentadeca-5,12-dien-9-yl] benzoate |
| SMILES | C/C1=C/CC[C@@](C)(OC(=O)c2ccccc2)[C@@H]2O[C@H](C1)[C@H]1CC(=O)C=C[C@H]12 |
| InChI | InChI=1S/C23H26O4/c1-15-7-6-12-23(2,27-22(25)16-8-4-3-5-9-16)21-18-11-10-17(24)14-19(18)20(13-15)26-21/h3-5,7-11,18-21H,6,12-14H2,1-2H3/b15-7-/t18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | UGERXKMABDKRFX-MFYXNUMDSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|