C24H38O3 — CID 154730802
[(1R,2R,6R,7R,8S,9R,12Z)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate (PubChem CID 154730802) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8S,9R,12Z)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate.
| Compound Name | [(1R,2R,6R,7R,8S,9R,12Z)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate |
|---|---|
| PubChem CID | 154730802 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | [(1R,2R,6R,7R,8S,9R,12Z)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate |
| SMILES | C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C/C(C)=C\CC[C@@](C)(OC(=O)CCC)[C@H]2O1 |
| InChI | InChI=1S/C24H38O3/c1-7-9-20(25)27-24(6)13-8-10-16(4)14-19-21-17(5)11-12-18(15(2)3)22(21)23(24)26-19/h10,15,18-19,21-23H,5,7-9,11-14H2,1-4,6H3/b16-10-/t18-,19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | LKOJWHNRHCEXFU-WCLKDHLOSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|